C28H31N3O4S — CID 149385041
N-cyclohexyl-3-[[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]sulfamoyl]benzamide (PubChem CID 149385041) has the molecular formula C28H31N3O4S and a molecular weight of 505.64 g/mol. Its IUPAC name is N-cyclohexyl-3-[[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]sulfamoyl]benzamide.
| Compound Name | N-cyclohexyl-3-[[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 149385041 |
| Molecular Formula | C28H31N3O4S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-cyclohexyl-3-[[4-(2-oxo-4-pyridin-3-ylbutyl)phenyl]sulfamoyl]benzamide |
| SMILES | O=C(CCc1cccnc1)Cc1ccc(NS(=O)(=O)c2cccc(C(=O)NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C28H31N3O4S/c32-26(16-13-22-6-5-17-29-20-22)18-21-11-14-25(15-12-21)31-36(34,35)27-10-4-7-23(19-27)28(33)30-24-8-2-1-3-9-24/h4-7,10-12,14-15,17,19-20,24,31H,1-3,8-9,13,16,18H2,(H,30,33) |
| InChIKey | YMKKYPFMKLNGGY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |