C18H22N4O2 — CID 52541173
N,N-diethyl-4-(pyridin-3-ylmethylcarbamoylamino)benzamide (PubChem CID 52541173) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N,N-diethyl-4-(pyridin-3-ylmethylcarbamoylamino)benzamide.
| Compound Name | N,N-diethyl-4-(pyridin-3-ylmethylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 52541173 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N,N-diethyl-4-(pyridin-3-ylmethylcarbamoylamino)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C18H22N4O2/c1-3-22(4-2)17(23)15-7-9-16(10-8-15)21-18(24)20-13-14-6-5-11-19-12-14/h5-12H,3-4,13H2,1-2H3,(H2,20,21,24) |
| InChIKey | KPXOTZNOJIUIRV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |