C22H25N3O5 — CID 55783917
2-(1,3-dioxoisoindol-2-yl)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutanamide (PubChem CID 55783917) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 55783917 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-methylbutanamide |
| SMILES | COCCOc1ccc(CNC(=O)C(C(C)C)N2C(=O)c3ccccc3C2=O)cn1 |
| InChI | InChI=1S/C22H25N3O5/c1-14(2)19(25-21(27)16-6-4-5-7-17(16)22(25)28)20(26)24-13-15-8-9-18(23-12-15)30-11-10-29-3/h4-9,12,14,19H,10-11,13H2,1-3H3,(H,24,26) |
| InChIKey | DUFYRBZRMWVEFW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|