C22H24N2O4 — CID 981255
(2R)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methoxyphenyl)ethyl]-3-methylbutanamide (PubChem CID 981255) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is (2R)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methoxyphenyl)ethyl]-3-methylbutanamide.
| Compound Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methoxyphenyl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 981255 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | (2R)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(4-methoxyphenyl)ethyl]-3-methylbutanamide |
| SMILES | COc1ccc(CCNC(=O)[C@@H](C(C)C)N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-14(2)19(24-21(26)17-6-4-5-7-18(17)22(24)27)20(25)23-13-12-15-8-10-16(28-3)11-9-15/h4-11,14,19H,12-13H2,1-3H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | OYDLZTSMGBJYJX-LJQANCHMSA-N |
| XLogP | 2.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|