C23H23N5O4 — CID 56524394
2-(1,3-dioxoisoindol-2-yl)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-methylbutanamide (PubChem CID 56524394) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-methylbutanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 56524394 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]-3-methylbutanamide |
| SMILES | COc1ccc(-c2n[nH]c(CNC(=O)C(C(C)C)N3C(=O)c4ccccc4C3=O)n2)cc1 |
| InChI | InChI=1S/C23H23N5O4/c1-13(2)19(28-22(30)16-6-4-5-7-17(16)23(28)31)21(29)24-12-18-25-20(27-26-18)14-8-10-15(32-3)11-9-14/h4-11,13,19H,12H2,1-3H3,(H,24,29)(H,25,26,27) |
| InChIKey | OPOKIBYEMNWBSS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|