C19H25N3O4 — CID 55749404
1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-[[3-(methoxymethyl)phenyl]methyl]urea (PubChem CID 55749404) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-[[3-(methoxymethyl)phenyl]methyl]urea.
| Compound Name | 1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-[[3-(methoxymethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55749404 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-3-[[3-(methoxymethyl)phenyl]methyl]urea |
| SMILES | COCCOc1ccc(CNC(=O)NCc2cccc(COC)c2)cn1 |
| InChI | InChI=1S/C19H25N3O4/c1-24-8-9-26-18-7-6-17(12-20-18)13-22-19(23)21-11-15-4-3-5-16(10-15)14-25-2/h3-7,10,12H,8-9,11,13-14H2,1-2H3,(H2,21,22,23) |
| InChIKey | OAVDNNIBZWVTMW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|