C20H21N3O5S — CID 55744413
N-[5-[[6-(2-methoxyethoxy)-3-pyridinyl]methylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide (PubChem CID 55744413) has the molecular formula C20H21N3O5S and a molecular weight of 415.47 g/mol. Its IUPAC name is N-[5-[[6-(2-methoxyethoxy)-3-pyridinyl]methylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[[6-(2-methoxyethoxy)-3-pyridinyl]methylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55744413 |
| Molecular Formula | C20H21N3O5S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | N-[5-[[6-(2-methoxyethoxy)-3-pyridinyl]methylcarbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
| SMILES | COCCOc1ccc(CNC(=O)c2sc(NC(=O)c3ccco3)cc2C)cn1 |
| InChI | InChI=1S/C20H21N3O5S/c1-13-10-17(23-19(24)15-4-3-7-27-15)29-18(13)20(25)22-12-14-5-6-16(21-11-14)28-9-8-26-2/h3-7,10-11H,8-9,12H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | KDERQHQXAHLEKD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|