C18H24N2O4S — CID 32954737
N-[5-[2-methoxyethyl(2-methylpropyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide (PubChem CID 32954737) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is N-[5-[2-methoxyethyl(2-methylpropyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[2-methoxyethyl(2-methylpropyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 32954737 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | N-[5-[2-methoxyethyl(2-methylpropyl)carbamoyl]-4-methylthiophen-2-yl]furan-2-carboxamide |
| SMILES | COCCN(CC(C)C)C(=O)c1sc(NC(=O)c2ccco2)cc1C |
| InChI | InChI=1S/C18H24N2O4S/c1-12(2)11-20(7-9-23-4)18(22)16-13(3)10-15(25-16)19-17(21)14-6-5-8-24-14/h5-6,8,10,12H,7,9,11H2,1-4H3,(H,19,21) |
| InChIKey | YTSOJIGVGSIDQX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |