C16H18N2O6S — CID 120702247
2-[[5-(furan-2-carbonylamino)-3-methylthiophene-2-carbonyl]amino]-4-methoxybutanoic acid (PubChem CID 120702247) has the molecular formula C16H18N2O6S and a molecular weight of 366.40 g/mol. Its IUPAC name is 2-[[5-(furan-2-carbonylamino)-3-methylthiophene-2-carbonyl]amino]-4-methoxybutanoic acid.
| Compound Name | 2-[[5-(furan-2-carbonylamino)-3-methylthiophene-2-carbonyl]amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 120702247 |
| Molecular Formula | C16H18N2O6S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-[[5-(furan-2-carbonylamino)-3-methylthiophene-2-carbonyl]amino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)c1sc(NC(=O)c2ccco2)cc1C)C(=O)O |
| InChI | InChI=1S/C16H18N2O6S/c1-9-8-12(18-14(19)11-4-3-6-24-11)25-13(9)15(20)17-10(16(21)22)5-7-23-2/h3-4,6,8,10H,5,7H2,1-2H3,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | UBHYIMNHWAHOEH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |