C15H24N2O3 — CID 111338040
1-(2-hydroxypentyl)-3-[[3-(methoxymethyl)phenyl]methyl]urea (PubChem CID 111338040) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2-hydroxypentyl)-3-[[3-(methoxymethyl)phenyl]methyl]urea.
| Compound Name | 1-(2-hydroxypentyl)-3-[[3-(methoxymethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 111338040 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-(2-hydroxypentyl)-3-[[3-(methoxymethyl)phenyl]methyl]urea |
| SMILES | CCCC(O)CNC(=O)NCc1cccc(COC)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-3-5-14(18)10-17-15(19)16-9-12-6-4-7-13(8-12)11-20-2/h4,6-8,14,18H,3,5,9-11H2,1-2H3,(H2,16,17,19) |
| InChIKey | SZJXPRSVAYXJKL-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |