C20H25N3O5S — CID 55744605
3-(cyclopropylmethylsulfamoyl)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide (PubChem CID 55744605) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is 3-(cyclopropylmethylsulfamoyl)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide.
| Compound Name | 3-(cyclopropylmethylsulfamoyl)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 55744605 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 3-(cyclopropylmethylsulfamoyl)-N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]benzamide |
| SMILES | COCCOc1ccc(CNC(=O)c2cccc(S(=O)(=O)NCC3CC3)c2)cn1 |
| InChI | InChI=1S/C20H25N3O5S/c1-27-9-10-28-19-8-7-16(12-21-19)13-22-20(24)17-3-2-4-18(11-17)29(25,26)23-14-15-5-6-15/h2-4,7-8,11-12,15,23H,5-6,9-10,13-14H2,1H3,(H,22,24) |
| InChIKey | OMEUDOABHYILQP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|