C22H29N3O5S — CID 55783694
N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 55783694) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 55783694 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-[[6-(2-methoxyethoxy)-3-pyridinyl]methyl]-4-(4-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | COCCOc1ccc(CNC(=O)c2ccc(S(=O)(=O)N3CCC(C)CC3)cc2)cn1 |
| InChI | InChI=1S/C22H29N3O5S/c1-17-9-11-25(12-10-17)31(27,28)20-6-4-19(5-7-20)22(26)24-16-18-3-8-21(23-15-18)30-14-13-29-2/h3-8,15,17H,9-14,16H2,1-2H3,(H,24,26) |
| InChIKey | ZLUNJPLCTCLUDK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|