C21H25FN2O5S — CID 55324470
[2-oxo-2-(1-phenylethylamino)ethyl] 2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 55324470) has the molecular formula C21H25FN2O5S and a molecular weight of 436.51 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylethylamino)ethyl] 2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | [2-oxo-2-(1-phenylethylamino)ethyl] 2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55324470 |
| Molecular Formula | C21H25FN2O5S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | [2-oxo-2-(1-phenylethylamino)ethyl] 2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(NC(=O)COC(=O)C(NS(=O)(=O)c1ccccc1F)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H25FN2O5S/c1-14(2)20(24-30(27,28)18-12-8-7-11-17(18)22)21(26)29-13-19(25)23-15(3)16-9-5-4-6-10-16/h4-12,14-15,20,24H,13H2,1-3H3,(H,23,25) |
| InChIKey | DVLPYXBYVMDXRP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |