C18H23ClFN3O4S — CID 119418923
N-(3-amino-4-methoxyphenyl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide;hydrochloride (PubChem CID 119418923) has the molecular formula C18H23ClFN3O4S and a molecular weight of 431.92 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119418923 |
| Molecular Formula | C18H23ClFN3O4S |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)C(NS(=O)(=O)c2ccccc2F)C(C)C)cc1N.Cl |
| InChI | InChI=1S/C18H22FN3O4S.ClH/c1-11(2)17(22-27(24,25)16-7-5-4-6-13(16)19)18(23)21-12-8-9-15(26-3)14(20)10-12;/h4-11,17,22H,20H2,1-3H3,(H,21,23);1H |
| InChIKey | KPJMSSJRKWBVLS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|