C18H24ClN3O5S — CID 119419366
N-(3-amino-4-methoxyphenyl)-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide;hydrochloride (PubChem CID 119419366) has the molecular formula C18H24ClN3O5S and a molecular weight of 429.93 g/mol. Its IUPAC name is N-(3-amino-4-methoxyphenyl)-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-(3-amino-4-methoxyphenyl)-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119419366 |
| Molecular Formula | C18H24ClN3O5S |
| Molecular Weight | 429.93 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | N-(3-amino-4-methoxyphenyl)-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)c2ccc(OC)c(S(=O)(=O)NC(C)C)c2)cc1N.Cl |
| InChI | InChI=1S/C18H23N3O5S.ClH/c1-11(2)21-27(23,24)17-9-12(5-7-16(17)26-4)18(22)20-13-6-8-15(25-3)14(19)10-13;/h5-11,21H,19H2,1-4H3,(H,20,22);1H |
| InChIKey | VBXZBFGECWPLKA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.93 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|