C16H25N3O6S — CID 22108264
tert-butyl N-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]carbamate (PubChem CID 22108264) has the molecular formula C16H25N3O6S and a molecular weight of 387.46 g/mol. Its IUPAC name is tert-butyl N-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]carbamate |
|---|---|
| PubChem CID | 22108264 |
| Molecular Formula | C16H25N3O6S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | tert-butyl N-[[4-methoxy-3-(propan-2-ylsulfamoyl)benzoyl]amino]carbamate |
| SMILES | COc1ccc(C(=O)NNC(=O)OC(C)(C)C)cc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C16H25N3O6S/c1-10(2)19-26(22,23)13-9-11(7-8-12(13)24-6)14(20)17-18-15(21)25-16(3,4)5/h7-10,19H,1-6H3,(H,17,20)(H,18,21) |
| InChIKey | XNDQTIHPPPXWDW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|