C24H22FN3O3S — CID 55941801
(2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]butanamide (PubChem CID 55941801) has the molecular formula C24H22FN3O3S and a molecular weight of 451.52 g/mol. Its IUPAC name is (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]butanamide.
| Compound Name | (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]butanamide |
|---|---|
| PubChem CID | 55941801 |
| Molecular Formula | C24H22FN3O3S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methyl-N-[3-(2-pyridin-2-ylethynyl)phenyl]butanamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)Nc1cccc(C#Cc2ccccn2)c1 |
| InChI | InChI=1S/C24H22FN3O3S/c1-17(2)23(28-32(30,31)22-12-4-3-11-21(22)25)24(29)27-20-10-7-8-18(16-20)13-14-19-9-5-6-15-26-19/h3-12,15-17,23,28H,1-2H3,(H,27,29)/t23-/m0/s1 |
| InChIKey | YAVNSJLKMMZIFD-QHCPKHFHSA-N |
| XLogP | 3.56 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|