C18H20FIN2O3S — CID 55937923
(2S)-2-[(2-fluorophenyl)sulfonylamino]-N-(4-iodo-2-methylphenyl)-3-methylbutanamide (PubChem CID 55937923) has the molecular formula C18H20FIN2O3S and a molecular weight of 490.34 g/mol. Its IUPAC name is (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-(4-iodo-2-methylphenyl)-3-methylbutanamide.
| Compound Name | (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-(4-iodo-2-methylphenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 55937923 |
| Molecular Formula | C18H20FIN2O3S |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 490.02 |
| IUPAC Name | (2S)-2-[(2-fluorophenyl)sulfonylamino]-N-(4-iodo-2-methylphenyl)-3-methylbutanamide |
| SMILES | Cc1cc(I)ccc1NC(=O)[C@@H](NS(=O)(=O)c1ccccc1F)C(C)C |
| InChI | InChI=1S/C18H20FIN2O3S/c1-11(2)17(18(23)21-15-9-8-13(20)10-12(15)3)22-26(24,25)16-7-5-4-6-14(16)19/h4-11,17,22H,1-3H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | YETVMVWUMAOUDL-KRWDZBQOSA-N |
| XLogP | 3.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|