C18H19FN4O3S — CID 27649237
(2S)-N-(1H-benzimidazol-2-yl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 27649237) has the molecular formula C18H19FN4O3S and a molecular weight of 390.44 g/mol. Its IUPAC name is (2S)-N-(1H-benzimidazol-2-yl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | (2S)-N-(1H-benzimidazol-2-yl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 27649237 |
| Molecular Formula | C18H19FN4O3S |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (2S)-N-(1H-benzimidazol-2-yl)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H19FN4O3S/c1-11(2)16(23-27(25,26)15-10-6-3-7-12(15)19)17(24)22-18-20-13-8-4-5-9-14(13)21-18/h3-11,16,23H,1-2H3,(H2,20,21,22,24)/t16-/m0/s1 |
| InChIKey | VAECLTDQCXLOFA-INIZCTEOSA-N |
| XLogP | 2.64 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |