C16H18N4O3S2 — CID 41078842
(2S)-N-(1H-benzimidazol-2-yl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide (PubChem CID 41078842) has the molecular formula C16H18N4O3S2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (2S)-N-(1H-benzimidazol-2-yl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide.
| Compound Name | (2S)-N-(1H-benzimidazol-2-yl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
|---|---|
| PubChem CID | 41078842 |
| Molecular Formula | C16H18N4O3S2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (2S)-N-(1H-benzimidazol-2-yl)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1cccs1)C(=O)Nc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H18N4O3S2/c1-10(2)14(20-25(22,23)13-8-5-9-24-13)15(21)19-16-17-11-6-3-4-7-12(11)18-16/h3-10,14,20H,1-2H3,(H2,17,18,19,21)/t14-/m0/s1 |
| InChIKey | XKSYFPWPHSAPCK-AWEZNQCLSA-N |
| XLogP | 2.57 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |