C17H19FN4O5S — CID 55937443
2-fluoro-N-[(2S)-3-methyl-1-[2-(2-nitrophenyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide (PubChem CID 55937443) has the molecular formula C17H19FN4O5S and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-fluoro-N-[(2S)-3-methyl-1-[2-(2-nitrophenyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-[(2S)-3-methyl-1-[2-(2-nitrophenyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 55937443 |
| Molecular Formula | C17H19FN4O5S |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-fluoro-N-[(2S)-3-methyl-1-[2-(2-nitrophenyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)NNc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19FN4O5S/c1-11(2)16(21-28(26,27)15-10-6-3-7-12(15)18)17(23)20-19-13-8-4-5-9-14(13)22(24)25/h3-11,16,19,21H,1-2H3,(H,20,23)/t16-/m0/s1 |
| InChIKey | QVZOODRUEPVDEE-INIZCTEOSA-N |
| XLogP | 2.18 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|