C20H20Cl3FN2O5S — CID 98406435
[(2R)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate (PubChem CID 98406435) has the molecular formula C20H20Cl3FN2O5S and a molecular weight of 525.81 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate.
| Compound Name | [(2R)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 98406435 |
| Molecular Formula | C20H20Cl3FN2O5S |
| Molecular Weight | 525.81 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | [(2R)-1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] (2S)-2-[(2-fluorophenyl)sulfonylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccccc1F)C(=O)O[C@H](C)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H20Cl3FN2O5S/c1-10(2)18(26-32(29,30)17-7-5-4-6-15(17)24)20(28)31-11(3)19(27)25-16-9-13(22)12(21)8-14(16)23/h4-11,18,26H,1-3H3,(H,25,27)/t11-,18+/m1/s1 |
| InChIKey | PMXRVTTYDWYOSF-ZMZPIMSZSA-N |
| XLogP | 4.66 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|