C20H22ClN3O7S — CID 40833990
[(2R)-1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] (2R)-2-(benzenesulfonamido)-3-methylbutanoate (PubChem CID 40833990) has the molecular formula C20H22ClN3O7S and a molecular weight of 483.93 g/mol. Its IUPAC name is [(2R)-1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] (2R)-2-(benzenesulfonamido)-3-methylbutanoate.
| Compound Name | [(2R)-1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] (2R)-2-(benzenesulfonamido)-3-methylbutanoate |
|---|---|
| PubChem CID | 40833990 |
| Molecular Formula | C20H22ClN3O7S |
| Molecular Weight | 483.93 g/mol |
| Exact Mass | 483.09 |
| IUPAC Name | [(2R)-1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] (2R)-2-(benzenesulfonamido)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1ccccc1)C(=O)O[C@H](C)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C20H22ClN3O7S/c1-12(2)18(23-32(29,30)15-7-5-4-6-8-15)20(26)31-13(3)19(25)22-17-11-14(24(27)28)9-10-16(17)21/h4-13,18,23H,1-3H3,(H,22,25)/t13-,18-/m1/s1 |
| InChIKey | OBWXCDPURBFRFE-FZKQIMNGSA-N |
| XLogP | 3.12 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.93 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|