C17H16Cl3FN2O — CID 2498448
(2S)-2-[(2-fluorophenyl)methyl-methylamino]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 2498448) has the molecular formula C17H16Cl3FN2O and a molecular weight of 389.69 g/mol. Its IUPAC name is (2S)-2-[(2-fluorophenyl)methyl-methylamino]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2S)-2-[(2-fluorophenyl)methyl-methylamino]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 2498448 |
| Molecular Formula | C17H16Cl3FN2O |
| Molecular Weight | 389.69 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | (2S)-2-[(2-fluorophenyl)methyl-methylamino]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1cc(Cl)c(Cl)cc1Cl)N(C)Cc1ccccc1F |
| InChI | InChI=1S/C17H16Cl3FN2O/c1-10(23(2)9-11-5-3-4-6-15(11)21)17(24)22-16-8-13(19)12(18)7-14(16)20/h3-8,10H,9H2,1-2H3,(H,22,24)/t10-/m0/s1 |
| InChIKey | DTLWMUBZSXSONR-JTQLQIEISA-N |
| XLogP | 5.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.69 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|