C17H21FN2O4S — CID 73419570
2-[(2-fluorophenyl)sulfonylamino]-N-[1-(furan-2-yl)ethyl]-3-methylbutanamide (PubChem CID 73419570) has the molecular formula C17H21FN2O4S and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)sulfonylamino]-N-[1-(furan-2-yl)ethyl]-3-methylbutanamide.
| Compound Name | 2-[(2-fluorophenyl)sulfonylamino]-N-[1-(furan-2-yl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 73419570 |
| Molecular Formula | C17H21FN2O4S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[(2-fluorophenyl)sulfonylamino]-N-[1-(furan-2-yl)ethyl]-3-methylbutanamide |
| SMILES | CC(NC(=O)C(NS(=O)(=O)c1ccccc1F)C(C)C)c1ccco1 |
| InChI | InChI=1S/C17H21FN2O4S/c1-11(2)16(17(21)19-12(3)14-8-6-10-24-14)20-25(22,23)15-9-5-4-7-13(15)18/h4-12,16,20H,1-3H3,(H,19,21) |
| InChIKey | JSHDEGDUFKHUFB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |