C18H24N2O5S — CID 39965551
(2R)-N-[(1R)-1-(furan-2-yl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 39965551) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is (2R)-N-[(1R)-1-(furan-2-yl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | (2R)-N-[(1R)-1-(furan-2-yl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 39965551 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (2R)-N-[(1R)-1-(furan-2-yl)ethyl]-2-[(4-methoxyphenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C(=O)N[C@H](C)c2ccco2)C(C)C)cc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-12(2)17(18(21)19-13(3)16-6-5-11-25-16)20-26(22,23)15-9-7-14(24-4)8-10-15/h5-13,17,20H,1-4H3,(H,19,21)/t13-,17-/m1/s1 |
| InChIKey | YUNLXCVJLLBMBO-CXAGYDPISA-N |
| XLogP | 2.47 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |