C19H20FN3O6S — CID 2551031
[2-(4-acetamidoanilino)-2-oxoethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate (PubChem CID 2551031) has the molecular formula C19H20FN3O6S and a molecular weight of 437.45 g/mol. Its IUPAC name is [2-(4-acetamidoanilino)-2-oxoethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | [2-(4-acetamidoanilino)-2-oxoethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 2551031 |
| Molecular Formula | C19H20FN3O6S |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | [2-(4-acetamidoanilino)-2-oxoethyl] (2S)-2-[(2-fluorophenyl)sulfonylamino]propanoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)COC(=O)[C@H](C)NS(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C19H20FN3O6S/c1-12(23-30(27,28)17-6-4-3-5-16(17)20)19(26)29-11-18(25)22-15-9-7-14(8-10-15)21-13(2)24/h3-10,12,23H,11H2,1-2H3,(H,21,24)(H,22,25)/t12-/m0/s1 |
| InChIKey | OBOFHVBPBPBPLA-LBPRGKRZSA-N |
| XLogP | 1.63 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |