C13H21NO4S2 — CID 81003022
tert-butyl (2R)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanoate (PubChem CID 81003022) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is tert-butyl (2R)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanoate.
| Compound Name | tert-butyl (2R)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 81003022 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | tert-butyl (2R)-3-methyl-2-(thiophen-2-ylsulfonylamino)butanoate |
| SMILES | CC(C)[C@@H](NS(=O)(=O)c1cccs1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO4S2/c1-9(2)11(12(15)18-13(3,4)5)14-20(16,17)10-7-6-8-19-10/h6-9,11,14H,1-5H3/t11-/m1/s1 |
| InChIKey | IRWYSICIYSFSRU-LLVKDONJSA-N |
| XLogP | 2.39 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |