C14H14NO4S2- — CID 8831032
(3S)-3-(4-methylphenyl)-3-(thiophen-2-ylsulfonylamino)propanoate (PubChem CID 8831032) has the molecular formula C14H14NO4S2- and a molecular weight of 324.40 g/mol. Its IUPAC name is (3S)-3-(4-methylphenyl)-3-(thiophen-2-ylsulfonylamino)propanoate.
| Compound Name | (3S)-3-(4-methylphenyl)-3-(thiophen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 8831032 |
| Molecular Formula | C14H14NO4S2- |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | (3S)-3-(4-methylphenyl)-3-(thiophen-2-ylsulfonylamino)propanoate |
| SMILES | Cc1ccc([C@H](CC(=O)[O-])NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H15NO4S2/c1-10-4-6-11(7-5-10)12(9-13(16)17)15-21(18,19)14-3-2-8-20-14/h2-8,12,15H,9H2,1H3,(H,16,17)/p-1/t12-/m0/s1 |
| InChIKey | OAUOZSDGPWFCQM-LBPRGKRZSA-M |
| XLogP | 1.22 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |