C20H27N3O3S2 — CID 8745531
N-[(1S)-1-(4-methylphenyl)propyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 8745531) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[(1S)-1-(4-methylphenyl)propyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-[(1S)-1-(4-methylphenyl)propyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 8745531 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-[(1S)-1-(4-methylphenyl)propyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CC[C@H](NC(=O)CN1CCN(S(=O)(=O)c2cccs2)CC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H27N3O3S2/c1-3-18(17-8-6-16(2)7-9-17)21-19(24)15-22-10-12-23(13-11-22)28(25,26)20-5-4-14-27-20/h4-9,14,18H,3,10-13,15H2,1-2H3,(H,21,24)/t18-/m0/s1 |
| InChIKey | ZKMUMWAZUIETQB-SFHVURJKSA-N |
| XLogP | 2.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |