C26H31N3O3S — CID 71903024
N-[1-(4-methylphenyl)propyl]-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 71903024) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)propyl]-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-[1-(4-methylphenyl)propyl]-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 71903024 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | N-[1-(4-methylphenyl)propyl]-2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CCC(NC(=O)CN1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H31N3O3S/c1-3-25(22-10-8-20(2)9-11-22)27-26(30)19-28-14-16-29(17-15-28)33(31,32)24-13-12-21-6-4-5-7-23(21)18-24/h4-13,18,25H,3,14-17,19H2,1-2H3,(H,27,30) |
| InChIKey | BSHMLCGFOWQRNK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |