C12H19N3O3S2 — CID 9111668
N,N-dimethyl-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 9111668) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N,N-dimethyl-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 9111668 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | N,N-dimethyl-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CN(C)C(=O)CN1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C12H19N3O3S2/c1-13(2)11(16)10-14-5-7-15(8-6-14)20(17,18)12-4-3-9-19-12/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | FXPSERVNWGUKMZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |