C14H17N3O3S2 — CID 17445671
1-(1H-pyrrol-2-yl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethanone (PubChem CID 17445671) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-(1H-pyrrol-2-yl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 1-(1H-pyrrol-2-yl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 17445671 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 1-(1H-pyrrol-2-yl)-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethanone |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2cccs2)CC1)c1ccc[nH]1 |
| InChI | InChI=1S/C14H17N3O3S2/c18-13(12-3-1-5-15-12)11-16-6-8-17(9-7-16)22(19,20)14-4-2-10-21-14/h1-5,10,15H,6-9,11H2 |
| InChIKey | DTCGPTVMNQEENX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |