C22H31N5O3S2 — CID 24680238
N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide (PubChem CID 24680238) has the molecular formula C22H31N5O3S2 and a molecular weight of 477.66 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 24680238 |
| Molecular Formula | C22H31N5O3S2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-2-(4-thiophen-2-ylsulfonylpiperazin-1-yl)acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CN3CCN(S(=O)(=O)c4cccs4)CC3)cc2)CC1 |
| InChI | InChI=1S/C22H31N5O3S2/c1-2-24-9-13-26(14-10-24)20-7-5-19(6-8-20)23-21(28)18-25-11-15-27(16-12-25)32(29,30)22-4-3-17-31-22/h3-8,17H,2,9-16,18H2,1H3,(H,23,28) |
| InChIKey | BISCTSPEPGBNSO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|