C23H32N4O3S2 — CID 55478487
N-[4-(azepan-1-yl)phenyl]-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide (PubChem CID 55478487) has the molecular formula C23H32N4O3S2 and a molecular weight of 476.67 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55478487 |
| Molecular Formula | C23H32N4O3S2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(NS(=O)(=O)c2cccs2)CC1)Nc1ccc(N2CCCCCC2)cc1 |
| InChI | InChI=1S/C23H32N4O3S2/c28-22(24-19-7-9-21(10-8-19)27-13-3-1-2-4-14-27)18-26-15-11-20(12-16-26)25-32(29,30)23-6-5-17-31-23/h5-10,17,20,25H,1-4,11-16,18H2,(H,24,28) |
| InChIKey | GBEXLFWXIYPACJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|