C17H20BrN3O3S2 — CID 55475048
N-(4-bromophenyl)-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide (PubChem CID 55475048) has the molecular formula C17H20BrN3O3S2 and a molecular weight of 458.40 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55475048 |
| Molecular Formula | C17H20BrN3O3S2 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 457.01 |
| IUPAC Name | N-(4-bromophenyl)-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(NS(=O)(=O)c2cccs2)CC1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H20BrN3O3S2/c18-13-3-5-14(6-4-13)19-16(22)12-21-9-7-15(8-10-21)20-26(23,24)17-2-1-11-25-17/h1-6,11,15,20H,7-10,12H2,(H,19,22) |
| InChIKey | AXACYDQUPHFBQV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |