C16H25N3O3S2 — CID 55648993
N-cyclopropyl-N-ethyl-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide (PubChem CID 55648993) has the molecular formula C16H25N3O3S2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-cyclopropyl-N-ethyl-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-N-ethyl-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55648993 |
| Molecular Formula | C16H25N3O3S2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-cyclopropyl-N-ethyl-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]acetamide |
| SMILES | CCN(C(=O)CN1CCC(NS(=O)(=O)c2cccs2)CC1)C1CC1 |
| InChI | InChI=1S/C16H25N3O3S2/c1-2-19(14-5-6-14)15(20)12-18-9-7-13(8-10-18)17-24(21,22)16-4-3-11-23-16/h3-4,11,13-14,17H,2,5-10,12H2,1H3 |
| InChIKey | WEOQZUHITOVFPD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |