C9H14N2O4S3 — CID 110871311
N-(1-methylsulfonylpyrrolidin-3-yl)thiophene-2-sulfonamide (PubChem CID 110871311) has the molecular formula C9H14N2O4S3 and a molecular weight of 310.42 g/mol. Its IUPAC name is N-(1-methylsulfonylpyrrolidin-3-yl)thiophene-2-sulfonamide.
| Compound Name | N-(1-methylsulfonylpyrrolidin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110871311 |
| Molecular Formula | C9H14N2O4S3 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | N-(1-methylsulfonylpyrrolidin-3-yl)thiophene-2-sulfonamide |
| SMILES | CS(=O)(=O)N1CCC(NS(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C9H14N2O4S3/c1-17(12,13)11-5-4-8(7-11)10-18(14,15)9-3-2-6-16-9/h2-3,6,8,10H,4-5,7H2,1H3 |
| InChIKey | LLLAAKMHZUMPNA-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |