C11H15FN2O4S2 — CID 110871302
4-fluoro-N-(1-methylsulfonylpyrrolidin-3-yl)benzenesulfonamide (PubChem CID 110871302) has the molecular formula C11H15FN2O4S2 and a molecular weight of 322.38 g/mol. Its IUPAC name is 4-fluoro-N-(1-methylsulfonylpyrrolidin-3-yl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-(1-methylsulfonylpyrrolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110871302 |
| Molecular Formula | C11H15FN2O4S2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 4-fluoro-N-(1-methylsulfonylpyrrolidin-3-yl)benzenesulfonamide |
| SMILES | CS(=O)(=O)N1CCC(NS(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C11H15FN2O4S2/c1-19(15,16)14-7-6-10(8-14)13-20(17,18)11-4-2-9(12)3-5-11/h2-5,10,13H,6-8H2,1H3 |
| InChIKey | MNISXHKJFOIAPZ-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |