C12H15F3N2O4S2 — CID 136573940
2,4,5-trifluoro-N-(1-methylsulfonylpiperidin-3-yl)benzenesulfonamide (PubChem CID 136573940) has the molecular formula C12H15F3N2O4S2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-(1-methylsulfonylpiperidin-3-yl)benzenesulfonamide.
| Compound Name | 2,4,5-trifluoro-N-(1-methylsulfonylpiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 136573940 |
| Molecular Formula | C12H15F3N2O4S2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 2,4,5-trifluoro-N-(1-methylsulfonylpiperidin-3-yl)benzenesulfonamide |
| SMILES | CS(=O)(=O)N1CCCC(NS(=O)(=O)c2cc(F)c(F)cc2F)C1 |
| InChI | InChI=1S/C12H15F3N2O4S2/c1-22(18,19)17-4-2-3-8(7-17)16-23(20,21)12-6-10(14)9(13)5-11(12)15/h5-6,8,16H,2-4,7H2,1H3 |
| InChIKey | ABURHUPUFNBZDK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|