C12H20N4O2S — CID 47406249
2,6-dimethyl-N-(1-methylsulfonylpiperidin-3-yl)pyrimidin-4-amine (PubChem CID 47406249) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2,6-dimethyl-N-(1-methylsulfonylpiperidin-3-yl)pyrimidin-4-amine.
| Compound Name | 2,6-dimethyl-N-(1-methylsulfonylpiperidin-3-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 47406249 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2,6-dimethyl-N-(1-methylsulfonylpiperidin-3-yl)pyrimidin-4-amine |
| SMILES | Cc1cc(NC2CCCN(S(C)(=O)=O)C2)nc(C)n1 |
| InChI | InChI=1S/C12H20N4O2S/c1-9-7-12(14-10(2)13-9)15-11-5-4-6-16(8-11)19(3,17)18/h7,11H,4-6,8H2,1-3H3,(H,13,14,15) |
| InChIKey | VVAAGHDCYSQZGQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |