C15H20N4O2S — CID 47982906
3-methyl-N-(1-methylsulfonylpiperidin-3-yl)quinoxalin-2-amine (PubChem CID 47982906) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 3-methyl-N-(1-methylsulfonylpiperidin-3-yl)quinoxalin-2-amine.
| Compound Name | 3-methyl-N-(1-methylsulfonylpiperidin-3-yl)quinoxalin-2-amine |
|---|---|
| PubChem CID | 47982906 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-methyl-N-(1-methylsulfonylpiperidin-3-yl)quinoxalin-2-amine |
| SMILES | Cc1nc2ccccc2nc1NC1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H20N4O2S/c1-11-15(18-14-8-4-3-7-13(14)16-11)17-12-6-5-9-19(10-12)22(2,20)21/h3-4,7-8,12H,5-6,9-10H2,1-2H3,(H,17,18) |
| InChIKey | MLFJITJPEVPOCD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |