C11H17N3O2S — CID 95808838
4-methyl-2-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrimidine (PubChem CID 95808838) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-methyl-2-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrimidine.
| Compound Name | 4-methyl-2-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrimidine |
|---|---|
| PubChem CID | 95808838 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-methyl-2-[(3R)-1-methylsulfonylpiperidin-3-yl]pyrimidine |
| SMILES | Cc1ccnc([C@@H]2CCCN(S(C)(=O)=O)C2)n1 |
| InChI | InChI=1S/C11H17N3O2S/c1-9-5-6-12-11(13-9)10-4-3-7-14(8-10)17(2,15)16/h5-6,10H,3-4,7-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | GRVQWJNEJXJWKL-SNVBAGLBSA-N |
| XLogP | 0.92 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |