C10H16N2O2S2 — CID 124966701
5-methyl-2-[(3R)-1-methylsulfonylpiperidin-3-yl]-1,3-thiazole (PubChem CID 124966701) has the molecular formula C10H16N2O2S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-methyl-2-[(3R)-1-methylsulfonylpiperidin-3-yl]-1,3-thiazole.
| Compound Name | 5-methyl-2-[(3R)-1-methylsulfonylpiperidin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 124966701 |
| Molecular Formula | C10H16N2O2S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 5-methyl-2-[(3R)-1-methylsulfonylpiperidin-3-yl]-1,3-thiazole |
| SMILES | Cc1cnc([C@@H]2CCCN(S(C)(=O)=O)C2)s1 |
| InChI | InChI=1S/C10H16N2O2S2/c1-8-6-11-10(15-8)9-4-3-5-12(7-9)16(2,13)14/h6,9H,3-5,7H2,1-2H3/t9-/m1/s1 |
| InChIKey | INOQCMAVFHAGFI-SECBINFHSA-N |
| XLogP | 1.59 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |