C10H15BrN2O4S3 — CID 37308568
5-bromo-N-(1-methylsulfonylpiperidin-4-yl)thiophene-2-sulfonamide (PubChem CID 37308568) has the molecular formula C10H15BrN2O4S3 and a molecular weight of 403.35 g/mol. Its IUPAC name is 5-bromo-N-(1-methylsulfonylpiperidin-4-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(1-methylsulfonylpiperidin-4-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 37308568 |
| Molecular Formula | C10H15BrN2O4S3 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 401.94 |
| IUPAC Name | 5-bromo-N-(1-methylsulfonylpiperidin-4-yl)thiophene-2-sulfonamide |
| SMILES | CS(=O)(=O)N1CCC(NS(=O)(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C10H15BrN2O4S3/c1-19(14,15)13-6-4-8(5-7-13)12-20(16,17)10-3-2-9(11)18-10/h2-3,8,12H,4-7H2,1H3 |
| InChIKey | RUWYHOWRVWDADP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |