C15H24N2O5S3 — CID 96539853
N-[1-[2-[(2R)-oxolan-2-yl]ethylsulfonyl]piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 96539853) has the molecular formula C15H24N2O5S3 and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[1-[2-[(2R)-oxolan-2-yl]ethylsulfonyl]piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[2-[(2R)-oxolan-2-yl]ethylsulfonyl]piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 96539853 |
| Molecular Formula | C15H24N2O5S3 |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | N-[1-[2-[(2R)-oxolan-2-yl]ethylsulfonyl]piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCN(S(=O)(=O)CC[C@H]2CCCO2)CC1)c1cccs1 |
| InChI | InChI=1S/C15H24N2O5S3/c18-24(19,12-7-14-3-1-10-22-14)17-8-5-13(6-9-17)16-25(20,21)15-4-2-11-23-15/h2,4,11,13-14,16H,1,3,5-10,12H2/t14-/m1/s1 |
| InChIKey | PTVADLQEMQNNFQ-CQSZACIVSA-N |
| XLogP | 1.39 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |