C16H22FNO3S — CID 97226472
(3S)-3-(4-fluorophenyl)-1-[2-[(2S)-oxolan-2-yl]ethylsulfonyl]pyrrolidine (PubChem CID 97226472) has the molecular formula C16H22FNO3S and a molecular weight of 327.42 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-1-[2-[(2S)-oxolan-2-yl]ethylsulfonyl]pyrrolidine.
| Compound Name | (3S)-3-(4-fluorophenyl)-1-[2-[(2S)-oxolan-2-yl]ethylsulfonyl]pyrrolidine |
|---|---|
| PubChem CID | 97226472 |
| Molecular Formula | C16H22FNO3S |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-1-[2-[(2S)-oxolan-2-yl]ethylsulfonyl]pyrrolidine |
| SMILES | O=S(=O)(CC[C@@H]1CCCO1)N1CC[C@@H](c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H22FNO3S/c17-15-5-3-13(4-6-15)14-7-9-18(12-14)22(19,20)11-8-16-2-1-10-21-16/h3-6,14,16H,1-2,7-12H2/t14-,16+/m1/s1 |
| InChIKey | VEZKTSOUVKNLEL-ZBFHGGJFSA-N |
| XLogP | 2.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |