C13H21NO3S2 — CID 97096482
2-[(2R)-oxolan-2-yl]-N-[(1R)-1-thiophen-2-ylpropyl]ethanesulfonamide (PubChem CID 97096482) has the molecular formula C13H21NO3S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-[(2R)-oxolan-2-yl]-N-[(1R)-1-thiophen-2-ylpropyl]ethanesulfonamide.
| Compound Name | 2-[(2R)-oxolan-2-yl]-N-[(1R)-1-thiophen-2-ylpropyl]ethanesulfonamide |
|---|---|
| PubChem CID | 97096482 |
| Molecular Formula | C13H21NO3S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-[(2R)-oxolan-2-yl]-N-[(1R)-1-thiophen-2-ylpropyl]ethanesulfonamide |
| SMILES | CC[C@@H](NS(=O)(=O)CC[C@H]1CCCO1)c1cccs1 |
| InChI | InChI=1S/C13H21NO3S2/c1-2-12(13-6-4-9-18-13)14-19(15,16)10-7-11-5-3-8-17-11/h4,6,9,11-12,14H,2-3,5,7-8,10H2,1H3/t11-,12-/m1/s1 |
| InChIKey | NFDSHDWENWMRBB-VXGBXAGGSA-N |
| XLogP | 2.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |