C11H18N2O3S2 — CID 47306222
N-(1-thiophen-2-ylpropyl)morpholine-4-sulfonamide (PubChem CID 47306222) has the molecular formula C11H18N2O3S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is N-(1-thiophen-2-ylpropyl)morpholine-4-sulfonamide.
| Compound Name | N-(1-thiophen-2-ylpropyl)morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 47306222 |
| Molecular Formula | C11H18N2O3S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-(1-thiophen-2-ylpropyl)morpholine-4-sulfonamide |
| SMILES | CCC(NS(=O)(=O)N1CCOCC1)c1cccs1 |
| InChI | InChI=1S/C11H18N2O3S2/c1-2-10(11-4-3-9-17-11)12-18(14,15)13-5-7-16-8-6-13/h3-4,9-10,12H,2,5-8H2,1H3 |
| InChIKey | NOTCOUKLHNCRNS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |