C13H16F4N2O3S — CID 172615033
N-[(1R)-2-fluoro-1-[4-(trifluoromethyl)phenyl]ethyl]morpholine-4-sulfonamide (PubChem CID 172615033) has the molecular formula C13H16F4N2O3S and a molecular weight of 356.34 g/mol. Its IUPAC name is N-[(1R)-2-fluoro-1-[4-(trifluoromethyl)phenyl]ethyl]morpholine-4-sulfonamide.
| Compound Name | N-[(1R)-2-fluoro-1-[4-(trifluoromethyl)phenyl]ethyl]morpholine-4-sulfonamide |
|---|---|
| PubChem CID | 172615033 |
| Molecular Formula | C13H16F4N2O3S |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-[(1R)-2-fluoro-1-[4-(trifluoromethyl)phenyl]ethyl]morpholine-4-sulfonamide |
| SMILES | O=S(=O)(N[C@@H](CF)c1ccc(C(F)(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C13H16F4N2O3S/c14-9-12(10-1-3-11(4-2-10)13(15,16)17)18-23(20,21)19-5-7-22-8-6-19/h1-4,12,18H,5-9H2/t12-/m0/s1 |
| InChIKey | CNNQWMCDQQKRBE-LBPRGKRZSA-N |
| XLogP | 1.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |